C18H16F3N3O2S — CID 71890843
5-[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one (PubChem CID 71890843) has the molecular formula C18H16F3N3O2S and a molecular weight of 395.41 g/mol. Its IUPAC name is 5-[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one.
| Compound Name | 5-[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 71890843 |
| Molecular Formula | C18H16F3N3O2S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 5-[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
| SMILES | O=c1[nH]c(-c2ccnc(OCC(F)(F)F)c2)nc2sc3c(c12)CCCCC3 |
| InChI | InChI=1S/C18H16F3N3O2S/c19-18(20,21)9-26-13-8-10(6-7-22-13)15-23-16(25)14-11-4-2-1-3-5-12(11)27-17(14)24-15/h6-8H,1-5,9H2,(H,23,24,25) |
| InChIKey | CPUPRTWJTNMHDM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |