About [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate
[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate (PubChem CID 71891840) has the molecular formula C19H22N2O4
and a molecular weight of 342.40 g/mol. Its IUPAC name is [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate.
Molecular Properties
| Compound Name | [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate |
| PubChem CID | 71891840 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)Oc2ccc(N3CCOC3=O)cc2)c(C)n1C(C)C |
| InChI | InChI=1S/C19H22N2O4/c1-12(2)21-13(3)11-17(14(21)4)18(22)25-16-7-5-15(6-8-16)20-9-10-24-19(20)23/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | XVDBASWXDRCULX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate?
The IUPAC name of [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate (CID 71891840) is [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate.
What is the SMILES notation for [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate?
The canonical SMILES for [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate is Cc1cc(C(=O)Oc2ccc(N3CCOC3=O)cc2)c(C)n1C(C)C.
What is the InChIKey of [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate?
The InChIKey is XVDBASWXDRCULX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O4/c1-12(2)21-13(3)11-17(14(21)4)18(22)25-16-7-5-15(6-8-16)20-9-10-24-19(20)23/h5-8,11-12H,9-10H2,1-4H3.
What are the key properties of [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate?
[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate has a molecular weight of 342.40 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-oxo-1,3-oxazolidin-3-yl)phenyl] 2,5-dimethyl-1-propan-2-ylpyrrole-3-carboxylate is sourced from PubChem (CID 71891840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).