About 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide
4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide (PubChem CID 71893290) has the molecular formula C17H22N6O2
and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide |
| PubChem CID | 71893290 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide |
| SMILES | CC(=O)N1CCN(C(=O)NCc2ccccc2Cn2cncn2)CC1 |
| InChI | InChI=1S/C17H22N6O2/c1-14(24)21-6-8-22(9-7-21)17(25)19-10-15-4-2-3-5-16(15)11-23-13-18-12-20-23/h2-5,12-13H,6-11H2,1H3,(H,19,25) |
| InChIKey | IJRVNPGVYAWDAI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide?
The IUPAC name of 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide (CID 71893290) is 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide.
What is the SMILES notation for 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide?
The canonical SMILES for 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide is CC(=O)N1CCN(C(=O)NCc2ccccc2Cn2cncn2)CC1.
What is the InChIKey of 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide?
The InChIKey is IJRVNPGVYAWDAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N6O2/c1-14(24)21-6-8-22(9-7-21)17(25)19-10-15-4-2-3-5-16(15)11-23-13-18-12-20-23/h2-5,12-13H,6-11H2,1H3,(H,19,25).
What are the key properties of 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide?
4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide has a molecular weight of 342.40 g/mol, XLogP of 0.70, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboxamide is sourced from PubChem (CID 71893290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).