C15H23N7O — CID 71893316
3-(4-methyl-1,2,4-triazol-3-yl)-N-(3-pyrazol-1-ylpropyl)piperidine-1-carboxamide (PubChem CID 71893316) has the molecular formula C15H23N7O and a molecular weight of 317.40 g/mol. Its IUPAC name is 3-(4-methyl-1,2,4-triazol-3-yl)-N-(3-pyrazol-1-ylpropyl)piperidine-1-carboxamide.
| Compound Name | 3-(4-methyl-1,2,4-triazol-3-yl)-N-(3-pyrazol-1-ylpropyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 71893316 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 3-(4-methyl-1,2,4-triazol-3-yl)-N-(3-pyrazol-1-ylpropyl)piperidine-1-carboxamide |
| SMILES | Cn1cnnc1C1CCCN(C(=O)NCCCn2cccn2)C1 |
| InChI | InChI=1S/C15H23N7O/c1-20-12-17-19-14(20)13-5-2-8-21(11-13)15(23)16-6-3-9-22-10-4-7-18-22/h4,7,10,12-13H,2-3,5-6,8-9,11H2,1H3,(H,16,23) |
| InChIKey | UAQBNMIJZQMSPV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|