About 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea
1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea (PubChem CID 71893335) has the molecular formula C15H24N4O3S
and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea.
Molecular Properties
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea |
| PubChem CID | 71893335 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea |
| SMILES | Cc1ccc(NCCCNC(=O)NCC2CCS(=O)(=O)C2)nc1 |
| InChI | InChI=1S/C15H24N4O3S/c1-12-3-4-14(18-9-12)16-6-2-7-17-15(20)19-10-13-5-8-23(21,22)11-13/h3-4,9,13H,2,5-8,10-11H2,1H3,(H,16,18)(H2,17,19,20) |
| InChIKey | VHCGKXOGVYFRKY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea?
The IUPAC name of 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea (CID 71893335) is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea.
What is the SMILES notation for 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea?
The canonical SMILES for 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea is Cc1ccc(NCCCNC(=O)NCC2CCS(=O)(=O)C2)nc1.
What is the InChIKey of 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea?
The InChIKey is VHCGKXOGVYFRKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O3S/c1-12-3-4-14(18-9-12)16-6-2-7-17-15(20)19-10-13-5-8-23(21,22)11-13/h3-4,9,13H,2,5-8,10-11H2,1H3,(H,16,18)(H2,17,19,20).
What are the key properties of 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea?
1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea has a molecular weight of 340.45 g/mol, XLogP of 0.93, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-[(5-methyl-2-pyridinyl)amino]propyl]urea is sourced from PubChem (CID 71893335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).