C13H22N6O2 — CID 71893357
4-acetyl-N-[3-(1,2,4-triazol-1-yl)propyl]-1,4-diazepane-1-carboxamide (PubChem CID 71893357) has the molecular formula C13H22N6O2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 4-acetyl-N-[3-(1,2,4-triazol-1-yl)propyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-acetyl-N-[3-(1,2,4-triazol-1-yl)propyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 71893357 |
| Molecular Formula | C13H22N6O2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 4-acetyl-N-[3-(1,2,4-triazol-1-yl)propyl]-1,4-diazepane-1-carboxamide |
| SMILES | CC(=O)N1CCCN(C(=O)NCCCn2cncn2)CC1 |
| InChI | InChI=1S/C13H22N6O2/c1-12(20)17-5-3-6-18(9-8-17)13(21)15-4-2-7-19-11-14-10-16-19/h10-11H,2-9H2,1H3,(H,15,21) |
| InChIKey | GMOKFWVLHAWZET-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|