C17H20N2O5 — CID 71894202
2-methyl-4-nitro-N-[(3,4,5-trimethoxyphenyl)methyl]aniline (PubChem CID 71894202) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-methyl-4-nitro-N-[(3,4,5-trimethoxyphenyl)methyl]aniline.
| Compound Name | 2-methyl-4-nitro-N-[(3,4,5-trimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 71894202 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-methyl-4-nitro-N-[(3,4,5-trimethoxyphenyl)methyl]aniline |
| SMILES | COc1cc(CNc2ccc([N+](=O)[O-])cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C17H20N2O5/c1-11-7-13(19(20)21)5-6-14(11)18-10-12-8-15(22-2)17(24-4)16(9-12)23-3/h5-9,18H,10H2,1-4H3 |
| InChIKey | QUPXMWGCTUGNFT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|