C17H9N7 — CID 718944
10-ethyl-1,3,6,10-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,8,11,13,15-heptaene-4,5,8-tricarbonitrile (PubChem CID 718944) has the molecular formula C17H9N7 and a molecular weight of 311.31 g/mol. Its IUPAC name is 10-ethyl-1,3,6,10-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,8,11,13,15-heptaene-4,5,8-tricarbonitrile.
| Compound Name | 10-ethyl-1,3,6,10-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,8,11,13,15-heptaene-4,5,8-tricarbonitrile |
|---|---|
| PubChem CID | 718944 |
| Molecular Formula | C17H9N7 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 10-ethyl-1,3,6,10-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,8,11,13,15-heptaene-4,5,8-tricarbonitrile |
| SMILES | CCn1c2ccccc2n2c3nc(C#N)c(C#N)nc3c(C#N)c12 |
| InChI | InChI=1S/C17H9N7/c1-2-23-13-5-3-4-6-14(13)24-16-15(10(7-18)17(23)24)21-11(8-19)12(9-20)22-16/h3-6H,2H2,1H3 |
| InChIKey | GCGYEHFYPLGTCI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 106.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |