About 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea
1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea (PubChem CID 71895896) has the molecular formula C16H14F2N2O4
and a molecular weight of 336.29 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea |
| PubChem CID | 71895896 |
| Molecular Formula | C16H14F2N2O4 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea |
| SMILES | O=C(Nc1ccc2c(c1)OC(F)(F)O2)N(Cc1ccco1)C1CC1 |
| InChI | InChI=1S/C16H14F2N2O4/c17-16(18)23-13-6-3-10(8-14(13)24-16)19-15(21)20(11-4-5-11)9-12-2-1-7-22-12/h1-3,6-8,11H,4-5,9H2,(H,19,21) |
| InChIKey | OLRNWHQKQBEQRT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea?
The IUPAC name of 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea (CID 71895896) is 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea.
What is the SMILES notation for 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea?
The canonical SMILES for 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea is O=C(Nc1ccc2c(c1)OC(F)(F)O2)N(Cc1ccco1)C1CC1.
What is the InChIKey of 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea?
The InChIKey is OLRNWHQKQBEQRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F2N2O4/c17-16(18)23-13-6-3-10(8-14(13)24-16)19-15(21)20(11-4-5-11)9-12-2-1-7-22-12/h1-3,6-8,11H,4-5,9H2,(H,19,21).
What are the key properties of 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea?
1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea has a molecular weight of 336.29 g/mol, XLogP of 3.80, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(furan-2-ylmethyl)urea is sourced from PubChem (CID 71895896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).