About 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide
3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide (PubChem CID 7189654) has the molecular formula C17H14N2O5S
and a molecular weight of 358.38 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide |
| PubChem CID | 7189654 |
| Molecular Formula | C17H14N2O5S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1)Nc1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C17H14N2O5S/c20-14(9-10-25(23,24)11-5-2-1-3-6-11)18-13-8-4-7-12-15(13)17(22)19-16(12)21/h1-8H,9-10H2,(H,18,20)(H,19,21,22) |
| InChIKey | AVYBGKWCWKWCSY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide?
The IUPAC name of 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide (CID 7189654) is 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide.
What is the SMILES notation for 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide?
The canonical SMILES for 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide is O=C(CCS(=O)(=O)c1ccccc1)Nc1cccc2c1C(=O)NC2=O.
What is the InChIKey of 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide?
The InChIKey is AVYBGKWCWKWCSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O5S/c20-14(9-10-25(23,24)11-5-2-1-3-6-11)18-13-8-4-7-12-15(13)17(22)19-16(12)21/h1-8H,9-10H2,(H,18,20)(H,19,21,22).
What are the key properties of 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide?
3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide has a molecular weight of 358.38 g/mol, XLogP of 1.37, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-N-(1,3-dioxoisoindol-4-yl)propanamide is sourced from PubChem (CID 7189654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).