C21H21N3O3 — CID 71897160
3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]-1-(2-phenylethyl)pyrrolidine-2,5-dione (PubChem CID 71897160) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]-1-(2-phenylethyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]-1-(2-phenylethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 71897160 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]-1-(2-phenylethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CCc2cc(NC3CC(=O)N(CCc4ccccc4)C3=O)ccc2N1 |
| InChI | InChI=1S/C21H21N3O3/c25-19-9-6-15-12-16(7-8-17(15)23-19)22-18-13-20(26)24(21(18)27)11-10-14-4-2-1-3-5-14/h1-5,7-8,12,18,22H,6,9-11,13H2,(H,23,25) |
| InChIKey | FKSXZNVJOLGRJP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|