About N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 71897344) has the molecular formula C16H23N3O3
and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
| PubChem CID | 71897344 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | Cc1cc(C)c(CNC(=O)C2CC(=O)N(C(C)C)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H23N3O3/c1-9(2)19-8-12(6-14(19)20)15(21)17-7-13-10(3)5-11(4)18-16(13)22/h5,9,12H,6-8H2,1-4H3,(H,17,21)(H,18,22) |
| InChIKey | REMZCOAKMZZQES-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide?
The IUPAC name of N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide (CID 71897344) is N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide.
What is the SMILES notation for N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide?
The canonical SMILES for N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide is Cc1cc(C)c(CNC(=O)C2CC(=O)N(C(C)C)C2)c(=O)[nH]1.
What is the InChIKey of N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide?
The InChIKey is REMZCOAKMZZQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O3/c1-9(2)19-8-12(6-14(19)20)15(21)17-7-13-10(3)5-11(4)18-16(13)22/h5,9,12H,6-8H2,1-4H3,(H,17,21)(H,18,22).
What are the key properties of N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide?
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide has a molecular weight of 305.38 g/mol, XLogP of 0.86, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide is sourced from PubChem (CID 71897344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).