About N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide
N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide (PubChem CID 71898003) has the molecular formula C14H25NO3S2
and a molecular weight of 319.49 g/mol. Its IUPAC name is N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide.
Molecular Properties
| Compound Name | N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide |
| PubChem CID | 71898003 |
| Molecular Formula | C14H25NO3S2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide |
| SMILES | CC(C)SCC(=O)N(C1CCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H25NO3S2/c1-11(2)19-9-14(16)15(12-5-3-4-6-12)13-7-8-20(17,18)10-13/h11-13H,3-10H2,1-2H3 |
| InChIKey | CKYTVZAODVXPKG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide?
The IUPAC name of N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide (CID 71898003) is N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide.
What is the SMILES notation for N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide?
The canonical SMILES for N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide is CC(C)SCC(=O)N(C1CCCC1)C1CCS(=O)(=O)C1.
What is the InChIKey of N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide?
The InChIKey is CKYTVZAODVXPKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO3S2/c1-11(2)19-9-14(16)15(12-5-3-4-6-12)13-7-8-20(17,18)10-13/h11-13H,3-10H2,1-2H3.
What are the key properties of N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide?
N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide has a molecular weight of 319.49 g/mol, XLogP of 2.09, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-2-propan-2-ylsulfanylacetamide is sourced from PubChem (CID 71898003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).