C19H13N3O5S — CID 7189863
N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-4-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 7189863) has the molecular formula C19H13N3O5S and a molecular weight of 395.40 g/mol. Its IUPAC name is N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-4-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-4-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 7189863 |
| Molecular Formula | C19H13N3O5S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-4-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(Nc1nc2cc3c(cc2s1)OCO3)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C19H13N3O5S/c23-16-5-6-17(24)22(16)11-3-1-10(2-4-11)18(25)21-19-20-12-7-13-14(27-9-26-13)8-15(12)28-19/h1-4,7-8H,5-6,9H2,(H,20,21,25) |
| InChIKey | LCDZYFXHKKUFAR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|