C19H16F3N3O2 — CID 71899387
[3-(trifluoromethyl)phenyl] 6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 71899387) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl] 6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | [3-(trifluoromethyl)phenyl] 6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 71899387 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [3-(trifluoromethyl)phenyl] 6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | Cc1nn(C)c2nc(C3CC3)cc(C(=O)Oc3cccc(C(F)(F)F)c3)c12 |
| InChI | InChI=1S/C19H16F3N3O2/c1-10-16-14(9-15(11-6-7-11)23-17(16)25(2)24-10)18(26)27-13-5-3-4-12(8-13)19(20,21)22/h3-5,8-9,11H,6-7H2,1-2H3 |
| InChIKey | IKHKVMXHTSSYKZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|