About 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one
2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one (PubChem CID 71899954) has the molecular formula C18H15ClN2O3
and a molecular weight of 342.78 g/mol. Its IUPAC name is 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one.
Molecular Properties
| Compound Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one |
| PubChem CID | 71899954 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2cnn1Cc1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H15ClN2O3/c19-15-8-12(9-16-17(15)24-7-3-6-23-16)11-21-18(22)14-5-2-1-4-13(14)10-20-21/h1-2,4-5,8-10H,3,6-7,11H2 |
| InChIKey | GUTHSIOXYAELJD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one?
The IUPAC name of 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one (CID 71899954) is 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one.
What is the SMILES notation for 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one?
The canonical SMILES for 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one is O=c1c2ccccc2cnn1Cc1cc(Cl)c2c(c1)OCCCO2.
What is the InChIKey of 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one?
The InChIKey is GUTHSIOXYAELJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN2O3/c19-15-8-12(9-16-17(15)24-7-3-6-23-16)11-21-18(22)14-5-2-1-4-13(14)10-20-21/h1-2,4-5,8-10H,3,6-7,11H2.
What are the key properties of 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one?
2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one has a molecular weight of 342.78 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]phthalazin-1-one is sourced from PubChem (CID 71899954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).