C19H21NO3S — CID 71901972
2-(benzenesulfonyl)-2-phenyl-1-piperidin-1-ylethanone (PubChem CID 71901972) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-phenyl-1-piperidin-1-ylethanone.
| Compound Name | 2-(benzenesulfonyl)-2-phenyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 71901972 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-(benzenesulfonyl)-2-phenyl-1-piperidin-1-ylethanone |
| SMILES | O=C(C(c1ccccc1)S(=O)(=O)c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C19H21NO3S/c21-19(20-14-8-3-9-15-20)18(16-10-4-1-5-11-16)24(22,23)17-12-6-2-7-13-17/h1-2,4-7,10-13,18H,3,8-9,14-15H2 |
| InChIKey | RMDVTFYNCJGCLA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |