C22H21N5O6S — CID 71902598
N-[[5-(diethylamino)-4-(2-nitrophenyl)sulfanylfuran-2-yl]methylideneamino]-3-nitrobenzamide (PubChem CID 71902598) has the molecular formula C22H21N5O6S and a molecular weight of 483.51 g/mol. Its IUPAC name is N-[[5-(diethylamino)-4-(2-nitrophenyl)sulfanylfuran-2-yl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[[5-(diethylamino)-4-(2-nitrophenyl)sulfanylfuran-2-yl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 71902598 |
| Molecular Formula | C22H21N5O6S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[[5-(diethylamino)-4-(2-nitrophenyl)sulfanylfuran-2-yl]methylideneamino]-3-nitrobenzamide |
| SMILES | CCN(CC)c1oc(C=NNC(=O)c2cccc([N+](=O)[O-])c2)cc1Sc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H21N5O6S/c1-3-25(4-2)22-20(34-19-11-6-5-10-18(19)27(31)32)13-17(33-22)14-23-24-21(28)15-8-7-9-16(12-15)26(29)30/h5-14H,3-4H2,1-2H3,(H,24,28) |
| InChIKey | BGHSVBLTWHOTQV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|