C24H28N4O7 — CID 71902659
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[(2-methoxyphenyl)methylamino]propanamide;oxalic acid (PubChem CID 71902659) has the molecular formula C24H28N4O7 and a molecular weight of 484.51 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[(2-methoxyphenyl)methylamino]propanamide;oxalic acid.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[(2-methoxyphenyl)methylamino]propanamide;oxalic acid |
|---|---|
| PubChem CID | 71902659 |
| Molecular Formula | C24H28N4O7 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[(2-methoxyphenyl)methylamino]propanamide;oxalic acid |
| SMILES | COc1ccccc1CNC(C)C(=O)Nc1c(C)n(C)n(-c2ccccc2)c1=O.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H26N4O3.C2H2O4/c1-15(23-14-17-10-8-9-13-19(17)29-4)21(27)24-20-16(2)25(3)26(22(20)28)18-11-6-5-7-12-18;3-1(4)2(5)6/h5-13,15,23H,14H2,1-4H3,(H,24,27);(H,3,4)(H,5,6) |
| InChIKey | DBMFYRFRNVWKRU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 151.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|