C14H17BrN6O2 — CID 71905749
3-bromo-5-nitro-N-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]pyridin-2-amine (PubChem CID 71905749) has the molecular formula C14H17BrN6O2 and a molecular weight of 381.23 g/mol. Its IUPAC name is 3-bromo-5-nitro-N-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]pyridin-2-amine.
| Compound Name | 3-bromo-5-nitro-N-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 71905749 |
| Molecular Formula | C14H17BrN6O2 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 3-bromo-5-nitro-N-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NCCCc2nnc3n2CCCC3)c(Br)c1 |
| InChI | InChI=1S/C14H17BrN6O2/c15-11-8-10(21(22)23)9-17-14(11)16-6-3-5-13-19-18-12-4-1-2-7-20(12)13/h8-9H,1-7H2,(H,16,17) |
| InChIKey | DXYPKLXHSCNKLU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|