C23H27N3O4 — CID 7190702
[(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-(adamantane-1-carbonylamino)acetate (PubChem CID 7190702) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-(adamantane-1-carbonylamino)acetate.
| Compound Name | [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-(adamantane-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 7190702 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-(adamantane-1-carbonylamino)acetate |
| SMILES | C[C@@H](OC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C23H27N3O4/c1-14(21(28)26-19-4-2-3-15(8-19)12-24)30-20(27)13-25-22(29)23-9-16-5-17(10-23)7-18(6-16)11-23/h2-4,8,14,16-18H,5-7,9-11,13H2,1H3,(H,25,29)(H,26,28)/t14-,16?,17?,18?,23?/m1/s1 |
| InChIKey | WKHPIWCFZAWUOT-HBDGIVRWSA-N |
| XLogP | 2.76 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |