C19H26N2O3S — CID 71907529
N-(4,4-dimethylcyclohexyl)sulfonyl-3-(1H-indol-3-yl)propanamide (PubChem CID 71907529) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)sulfonyl-3-(1H-indol-3-yl)propanamide.
| Compound Name | N-(4,4-dimethylcyclohexyl)sulfonyl-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 71907529 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)sulfonyl-3-(1H-indol-3-yl)propanamide |
| SMILES | CC1(C)CCC(S(=O)(=O)NC(=O)CCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H26N2O3S/c1-19(2)11-9-15(10-12-19)25(23,24)21-18(22)8-7-14-13-20-17-6-4-3-5-16(14)17/h3-6,13,15,20H,7-12H2,1-2H3,(H,21,22) |
| InChIKey | AMQDSPVYYVNFCS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |