About [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate
[2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate (PubChem CID 71907743) has the molecular formula C19H25NO5
and a molecular weight of 347.41 g/mol. Its IUPAC name is [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate.
Molecular Properties
| Compound Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate |
| PubChem CID | 71907743 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate |
| SMILES | CN(C(=O)COC(=O)c1cccc(C2OCCO2)c1)C1CCCCC1 |
| InChI | InChI=1S/C19H25NO5/c1-20(16-8-3-2-4-9-16)17(21)13-25-18(22)14-6-5-7-15(12-14)19-23-10-11-24-19/h5-7,12,16,19H,2-4,8-11,13H2,1H3 |
| InChIKey | RRUFPBQFJXNZHZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate?
The IUPAC name of [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate (CID 71907743) is [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate.
What is the SMILES notation for [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate?
The canonical SMILES for [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate is CN(C(=O)COC(=O)c1cccc(C2OCCO2)c1)C1CCCCC1.
What is the InChIKey of [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate?
The InChIKey is RRUFPBQFJXNZHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO5/c1-20(16-8-3-2-4-9-16)17(21)13-25-18(22)14-6-5-7-15(12-14)19-23-10-11-24-19/h5-7,12,16,19H,2-4,8-11,13H2,1H3.
What are the key properties of [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate?
[2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate has a molecular weight of 347.41 g/mol, XLogP of 2.68, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxolan-2-yl)benzoate is sourced from PubChem (CID 71907743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).