About 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide
4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide (PubChem CID 71908368) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide |
| PubChem CID | 71908368 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c[nH]c(C(=O)NCc2cnn(C)c2C)c1 |
| InChI | InChI=1S/C13H16N4O2/c1-8-11(7-16-17(8)3)6-15-13(19)12-4-10(5-14-12)9(2)18/h4-5,7,14H,6H2,1-3H3,(H,15,19) |
| InChIKey | NOFAHCIDUNZYQX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide (CID 71908368) is 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide is CC(=O)c1c[nH]c(C(=O)NCc2cnn(C)c2C)c1.
What is the InChIKey of 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide?
The InChIKey is NOFAHCIDUNZYQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2/c1-8-11(7-16-17(8)3)6-15-13(19)12-4-10(5-14-12)9(2)18/h4-5,7,14H,6H2,1-3H3,(H,15,19).
What are the key properties of 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide?
4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide has a molecular weight of 260.30 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 71908368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).