C19H24N6O — CID 71908781
1-[3-[(2-propan-2-ylimidazol-1-yl)methyl]phenyl]-3-[1-(1H-pyrazol-4-yl)ethyl]urea (PubChem CID 71908781) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-[3-[(2-propan-2-ylimidazol-1-yl)methyl]phenyl]-3-[1-(1H-pyrazol-4-yl)ethyl]urea.
| Compound Name | 1-[3-[(2-propan-2-ylimidazol-1-yl)methyl]phenyl]-3-[1-(1H-pyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 71908781 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-[3-[(2-propan-2-ylimidazol-1-yl)methyl]phenyl]-3-[1-(1H-pyrazol-4-yl)ethyl]urea |
| SMILES | CC(C)c1nccn1Cc1cccc(NC(=O)NC(C)c2cn[nH]c2)c1 |
| InChI | InChI=1S/C19H24N6O/c1-13(2)18-20-7-8-25(18)12-15-5-4-6-17(9-15)24-19(26)23-14(3)16-10-21-22-11-16/h4-11,13-14H,12H2,1-3H3,(H,21,22)(H2,23,24,26) |
| InChIKey | URNWGBNHHLJDCW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |