C16H16N4O2 — CID 71908786
N-(1-amino-1-oxopent-4-yn-2-yl)-5-methyl-1-phenylpyrazole-3-carboxamide (PubChem CID 71908786) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(1-amino-1-oxopent-4-yn-2-yl)-5-methyl-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-(1-amino-1-oxopent-4-yn-2-yl)-5-methyl-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71908786 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(1-amino-1-oxopent-4-yn-2-yl)-5-methyl-1-phenylpyrazole-3-carboxamide |
| SMILES | C#CCC(NC(=O)c1cc(C)n(-c2ccccc2)n1)C(N)=O |
| InChI | InChI=1S/C16H16N4O2/c1-3-7-13(15(17)21)18-16(22)14-10-11(2)20(19-14)12-8-5-4-6-9-12/h1,4-6,8-10,13H,7H2,2H3,(H2,17,21)(H,18,22) |
| InChIKey | ISMBQFJRRVHVEF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|