About N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide
N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide (PubChem CID 71909654) has the molecular formula C11H8N4O2S2
and a molecular weight of 292.35 g/mol. Its IUPAC name is N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide.
Molecular Properties
| Compound Name | N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide |
| PubChem CID | 71909654 |
| Molecular Formula | C11H8N4O2S2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide |
| SMILES | O=S(=O)(Nc1nncs1)c1cccc2ncccc12 |
| InChI | InChI=1S/C11H8N4O2S2/c16-19(17,15-11-14-13-7-18-11)10-5-1-4-9-8(10)3-2-6-12-9/h1-7H,(H,14,15) |
| InChIKey | OXMJQYUKAYZRBU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide?
The IUPAC name of N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide (CID 71909654) is N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide.
What is the SMILES notation for N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide?
The canonical SMILES for N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide is O=S(=O)(Nc1nncs1)c1cccc2ncccc12.
What is the InChIKey of N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide?
The InChIKey is OXMJQYUKAYZRBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O2S2/c16-19(17,15-11-14-13-7-18-11)10-5-1-4-9-8(10)3-2-6-12-9/h1-7H,(H,14,15).
What are the key properties of N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide?
N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide has a molecular weight of 292.35 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3,4-thiadiazol-2-yl)quinoline-5-sulfonamide is sourced from PubChem (CID 71909654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).