About 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide
1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide (PubChem CID 71909657) has the molecular formula C9H13N5O2S2
and a molecular weight of 287.37 g/mol. Its IUPAC name is 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide |
| PubChem CID | 71909657 |
| Molecular Formula | C9H13N5O2S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide |
| SMILES | CCC(C)n1cnc(S(=O)(=O)Nc2nncs2)c1 |
| InChI | InChI=1S/C9H13N5O2S2/c1-3-7(2)14-4-8(10-5-14)18(15,16)13-9-12-11-6-17-9/h4-7H,3H2,1-2H3,(H,12,13) |
| InChIKey | PPDUYDXWYLIJSQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide?
The IUPAC name of 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide (CID 71909657) is 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide.
What is the SMILES notation for 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide?
The canonical SMILES for 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide is CCC(C)n1cnc(S(=O)(=O)Nc2nncs2)c1.
What is the InChIKey of 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide?
The InChIKey is PPDUYDXWYLIJSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O2S2/c1-3-7(2)14-4-8(10-5-14)18(15,16)13-9-12-11-6-17-9/h4-7H,3H2,1-2H3,(H,12,13).
What are the key properties of 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide?
1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide has a molecular weight of 287.37 g/mol, XLogP of 1.51, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-N-(1,3,4-thiadiazol-2-yl)imidazole-4-sulfonamide is sourced from PubChem (CID 71909657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).