About N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide
N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 71909687) has the molecular formula C17H16N4O2S
and a molecular weight of 340.41 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
| PubChem CID | 71909687 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | COCCN(C(=O)c1sc2nccn2c1C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H16N4O2S/c1-12-15(24-17-19-7-8-20(12)17)16(22)21(9-10-23-2)14-5-3-13(11-18)4-6-14/h3-8H,9-10H2,1-2H3 |
| InChIKey | DVSSZWSCBPZQLN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide?
The IUPAC name of N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide (CID 71909687) is N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide.
What is the SMILES notation for N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide?
The canonical SMILES for N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide is COCCN(C(=O)c1sc2nccn2c1C)c1ccc(C#N)cc1.
What is the InChIKey of N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide?
The InChIKey is DVSSZWSCBPZQLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O2S/c1-12-15(24-17-19-7-8-20(12)17)16(22)21(9-10-23-2)14-5-3-13(11-18)4-6-14/h3-8H,9-10H2,1-2H3.
What are the key properties of N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide?
N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide has a molecular weight of 340.41 g/mol, XLogP of 2.87, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyanophenyl)-N-(2-methoxyethyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide is sourced from PubChem (CID 71909687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).