About 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane
5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane (PubChem CID 71911267) has the molecular formula C9H22N2O3S
and a molecular weight of 238.35 g/mol. Its IUPAC name is 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane.
Molecular Properties
| Compound Name | 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane |
| PubChem CID | 71911267 |
| Molecular Formula | C9H22N2O3S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane |
| SMILES | CN(C)S(=O)(=O)NCCCC(C)(C)CO |
| InChI | InChI=1S/C9H22N2O3S/c1-9(2,8-12)6-5-7-10-15(13,14)11(3)4/h10,12H,5-8H2,1-4H3 |
| InChIKey | SFKZMKPBUBWQPI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane?
The IUPAC name of 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane (CID 71911267) is 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane.
What is the SMILES notation for 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane?
The canonical SMILES for 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane is CN(C)S(=O)(=O)NCCCC(C)(C)CO.
What is the InChIKey of 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane?
The InChIKey is SFKZMKPBUBWQPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O3S/c1-9(2,8-12)6-5-7-10-15(13,14)11(3)4/h10,12H,5-8H2,1-4H3.
What are the key properties of 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane?
5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane has a molecular weight of 238.35 g/mol, XLogP of 0.18, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylsulfamoylamino)-1-hydroxy-2,2-dimethylpentane is sourced from PubChem (CID 71911267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).