C20H27N3O2 — CID 71912128
1-cyclopentyl-N-[3-(2-oxopyrrolidin-1-yl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 71912128) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-cyclopentyl-N-[3-(2-oxopyrrolidin-1-yl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-cyclopentyl-N-[3-(2-oxopyrrolidin-1-yl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71912128 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-cyclopentyl-N-[3-(2-oxopyrrolidin-1-yl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(N2CCCC2=O)c1)C1CCCN1C1CCCC1 |
| InChI | InChI=1S/C20H27N3O2/c24-19-11-5-13-23(19)17-9-3-6-15(14-17)21-20(25)18-10-4-12-22(18)16-7-1-2-8-16/h3,6,9,14,16,18H,1-2,4-5,7-8,10-13H2,(H,21,25) |
| InChIKey | FPSWCKSOKJGHHE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |