About (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate
(4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate (PubChem CID 71912327) has the molecular formula C22H19N3O5S
and a molecular weight of 437.48 g/mol. Its IUPAC name is (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate.
Molecular Properties
| Compound Name | (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate |
| PubChem CID | 71912327 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate |
| SMILES | Cn1ncnc1COc1ccc(S(=O)(=O)Oc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H19N3O5S/c1-25-22(23-16-24-25)15-28-17-11-13-21(14-12-17)31(26,27)30-20-9-7-19(8-10-20)29-18-5-3-2-4-6-18/h2-14,16H,15H2,1H3 |
| InChIKey | GBRMNKQACTYGAI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate?
The IUPAC name of (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate (CID 71912327) is (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate.
What is the SMILES notation for (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate?
The canonical SMILES for (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate is Cn1ncnc1COc1ccc(S(=O)(=O)Oc2ccc(Oc3ccccc3)cc2)cc1.
What is the InChIKey of (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate?
The InChIKey is GBRMNKQACTYGAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O5S/c1-25-22(23-16-24-25)15-28-17-11-13-21(14-12-17)31(26,27)30-20-9-7-19(8-10-20)29-18-5-3-2-4-6-18/h2-14,16H,15H2,1H3.
What are the key properties of (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate?
(4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate has a molecular weight of 437.48 g/mol, XLogP of 3.95, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenoxyphenyl) 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonate is sourced from PubChem (CID 71912327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).