C15H16N4O4S2 — CID 7191243
N-[5-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 7191243) has the molecular formula C15H16N4O4S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[5-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | N-[5-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 7191243 |
| Molecular Formula | C15H16N4O4S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-[5-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nnc(SCC(=O)Nc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C15H16N4O4S2/c1-2-3-12(20)17-14-18-19-15(25-14)24-7-13(21)16-9-4-5-10-11(6-9)23-8-22-10/h4-6H,2-3,7-8H2,1H3,(H,16,21)(H,17,18,20) |
| InChIKey | LCSIPFOVHZXKKZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|