About 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline
2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline (PubChem CID 71912459) has the molecular formula C13H16N2O2S3
and a molecular weight of 328.48 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline.
Molecular Properties
| Compound Name | 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline |
| PubChem CID | 71912459 |
| Molecular Formula | C13H16N2O2S3 |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline |
| SMILES | CS(=O)(=O)c1ccccc1NCCCSc1nccs1 |
| InChI | InChI=1S/C13H16N2O2S3/c1-20(16,17)12-6-3-2-5-11(12)14-7-4-9-18-13-15-8-10-19-13/h2-3,5-6,8,10,14H,4,7,9H2,1H3 |
| InChIKey | LMSOUTXPOCWXDP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline?
The IUPAC name of 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline (CID 71912459) is 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline.
What is the SMILES notation for 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline?
The canonical SMILES for 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline is CS(=O)(=O)c1ccccc1NCCCSc1nccs1.
What is the InChIKey of 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline?
The InChIKey is LMSOUTXPOCWXDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S3/c1-20(16,17)12-6-3-2-5-11(12)14-7-4-9-18-13-15-8-10-19-13/h2-3,5-6,8,10,14H,4,7,9H2,1H3.
What are the key properties of 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline?
2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline has a molecular weight of 328.48 g/mol, XLogP of 3.14, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]aniline is sourced from PubChem (CID 71912459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).