C20H13N5OS — CID 71912900
6-anilino-3-thiophen-2-yl-[1,2,4]triazino[2,3-c]quinazolin-2-one (PubChem CID 71912900) has the molecular formula C20H13N5OS and a molecular weight of 371.43 g/mol. Its IUPAC name is 6-anilino-3-thiophen-2-yl-[1,2,4]triazino[2,3-c]quinazolin-2-one.
| Compound Name | 6-anilino-3-thiophen-2-yl-[1,2,4]triazino[2,3-c]quinazolin-2-one |
|---|---|
| PubChem CID | 71912900 |
| Molecular Formula | C20H13N5OS |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 6-anilino-3-thiophen-2-yl-[1,2,4]triazino[2,3-c]quinazolin-2-one |
| SMILES | O=c1nc2c3ccccc3nc(Nc3ccccc3)n2nc1-c1cccs1 |
| InChI | InChI=1S/C20H13N5OS/c26-19-17(16-11-6-12-27-16)24-25-18(23-19)14-9-4-5-10-15(14)22-20(25)21-13-7-2-1-3-8-13/h1-12H,(H,21,22) |
| InChIKey | YRSOFTJINNIWSE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|