C18H16N4O — CID 71912920
6,6-dimethyl-3-phenyl-7H-[1,2,4]triazino[2,3-c]quinazolin-2-one (PubChem CID 71912920) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 6,6-dimethyl-3-phenyl-7H-[1,2,4]triazino[2,3-c]quinazolin-2-one.
| Compound Name | 6,6-dimethyl-3-phenyl-7H-[1,2,4]triazino[2,3-c]quinazolin-2-one |
|---|---|
| PubChem CID | 71912920 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 6,6-dimethyl-3-phenyl-7H-[1,2,4]triazino[2,3-c]quinazolin-2-one |
| SMILES | CC1(C)Nc2ccccc2-c2nc(=O)c(-c3ccccc3)nn21 |
| InChI | InChI=1S/C18H16N4O/c1-18(2)20-14-11-7-6-10-13(14)16-19-17(23)15(21-22(16)18)12-8-4-3-5-9-12/h3-11,20H,1-2H3 |
| InChIKey | ZLTMZOZHWGQFSO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |