C22H21N5O2 — CID 71912921
3-(3,4-dimethylphenyl)-6-morpholin-4-yl-[1,2,4]triazino[2,3-c]quinazolin-2-one (PubChem CID 71912921) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-6-morpholin-4-yl-[1,2,4]triazino[2,3-c]quinazolin-2-one.
| Compound Name | 3-(3,4-dimethylphenyl)-6-morpholin-4-yl-[1,2,4]triazino[2,3-c]quinazolin-2-one |
|---|---|
| PubChem CID | 71912921 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-6-morpholin-4-yl-[1,2,4]triazino[2,3-c]quinazolin-2-one |
| SMILES | Cc1ccc(-c2nn3c(N4CCOCC4)nc4ccccc4c3nc2=O)cc1C |
| InChI | InChI=1S/C22H21N5O2/c1-14-7-8-16(13-15(14)2)19-21(28)24-20-17-5-3-4-6-18(17)23-22(27(20)25-19)26-9-11-29-12-10-26/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | NSMIWCWLSDWZLS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|