C10H7N5O — CID 71912937
3-methyl-[1,2,4]triazino[2,3-c][1,2,3]benzotriazin-2-one (PubChem CID 71912937) has the molecular formula C10H7N5O and a molecular weight of 213.20 g/mol. Its IUPAC name is 3-methyl-[1,2,4]triazino[2,3-c][1,2,3]benzotriazin-2-one.
| Compound Name | 3-methyl-[1,2,4]triazino[2,3-c][1,2,3]benzotriazin-2-one |
|---|---|
| PubChem CID | 71912937 |
| Molecular Formula | C10H7N5O |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 3-methyl-[1,2,4]triazino[2,3-c][1,2,3]benzotriazin-2-one |
| SMILES | Cc1nn2nnc3ccccc3c2nc1=O |
| InChI | InChI=1S/C10H7N5O/c1-6-10(16)11-9-7-4-2-3-5-8(7)12-14-15(9)13-6/h2-5H,1H3 |
| InChIKey | SLKVKXUGHHSMSO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 73.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|