C23H16ClN5O — CID 71912955
6-(4-chloroanilino)-3-(4-methylphenyl)-[1,2,4]triazino[2,3-c]quinazolin-2-one (PubChem CID 71912955) has the molecular formula C23H16ClN5O and a molecular weight of 413.87 g/mol. Its IUPAC name is 6-(4-chloroanilino)-3-(4-methylphenyl)-[1,2,4]triazino[2,3-c]quinazolin-2-one.
| Compound Name | 6-(4-chloroanilino)-3-(4-methylphenyl)-[1,2,4]triazino[2,3-c]quinazolin-2-one |
|---|---|
| PubChem CID | 71912955 |
| Molecular Formula | C23H16ClN5O |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 6-(4-chloroanilino)-3-(4-methylphenyl)-[1,2,4]triazino[2,3-c]quinazolin-2-one |
| SMILES | Cc1ccc(-c2nn3c(Nc4ccc(Cl)cc4)nc4ccccc4c3nc2=O)cc1 |
| InChI | InChI=1S/C23H16ClN5O/c1-14-6-8-15(9-7-14)20-22(30)27-21-18-4-2-3-5-19(18)26-23(29(21)28-20)25-17-12-10-16(24)11-13-17/h2-13H,1H3,(H,25,26) |
| InChIKey | XAWANGVVPGSTEM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|