About [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate
[1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 71913304) has the molecular formula C17H14BrN3O2
and a molecular weight of 372.22 g/mol. Its IUPAC name is [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate.
Molecular Properties
| Compound Name | [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate |
| PubChem CID | 71913304 |
| Molecular Formula | C17H14BrN3O2 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | Cc1nn2cccnc2c1C(=O)OC1(c2ccccc2Br)CC1 |
| InChI | InChI=1S/C17H14BrN3O2/c1-11-14(15-19-9-4-10-21(15)20-11)16(22)23-17(7-8-17)12-5-2-3-6-13(12)18/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | INWVRFHXWPLFCN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate?
The IUPAC name of [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate (CID 71913304) is [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate.
What is the SMILES notation for [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate?
The canonical SMILES for [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate is Cc1nn2cccnc2c1C(=O)OC1(c2ccccc2Br)CC1.
What is the InChIKey of [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate?
The InChIKey is INWVRFHXWPLFCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrN3O2/c1-11-14(15-19-9-4-10-21(15)20-11)16(22)23-17(7-8-17)12-5-2-3-6-13(12)18/h2-6,9-10H,7-8H2,1H3.
What are the key properties of [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate?
[1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate has a molecular weight of 372.22 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-bromophenyl)cyclopropyl] 2-methylpyrazolo[1,5-a]pyrimidine-3-carboxylate is sourced from PubChem (CID 71913304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).