C18H27N3O2 — CID 71913541
N-(2,5-dimethylphenyl)-2-[4-(oxolan-3-yl)piperazin-1-yl]acetamide (PubChem CID 71913541) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[4-(oxolan-3-yl)piperazin-1-yl]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[4-(oxolan-3-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 71913541 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[4-(oxolan-3-yl)piperazin-1-yl]acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CN2CCN(C3CCOC3)CC2)c1 |
| InChI | InChI=1S/C18H27N3O2/c1-14-3-4-15(2)17(11-14)19-18(22)12-20-6-8-21(9-7-20)16-5-10-23-13-16/h3-4,11,16H,5-10,12-13H2,1-2H3,(H,19,22) |
| InChIKey | HTWXRAXVNYXEKS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |