C15H13ClF2N2O2 — CID 71913606
3-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]benzamide (PubChem CID 71913606) has the molecular formula C15H13ClF2N2O2 and a molecular weight of 326.73 g/mol. Its IUPAC name is 3-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]benzamide.
| Compound Name | 3-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]benzamide |
|---|---|
| PubChem CID | 71913606 |
| Molecular Formula | C15H13ClF2N2O2 |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 3-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]benzamide |
| SMILES | NC(=O)c1cccc(NCc2ccc(OC(F)F)c(Cl)c2)c1 |
| InChI | InChI=1S/C15H13ClF2N2O2/c16-12-6-9(4-5-13(12)22-15(17)18)8-20-11-3-1-2-10(7-11)14(19)21/h1-7,15,20H,8H2,(H2,19,21) |
| InChIKey | FNGBLUUWKZSWNJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |