C20H20F3NO6 — CID 71913629
[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl] 4-acetyloxy-3-methoxybenzoate (PubChem CID 71913629) has the molecular formula C20H20F3NO6 and a molecular weight of 427.38 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl] 4-acetyloxy-3-methoxybenzoate.
| Compound Name | [2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl] 4-acetyloxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 71913629 |
| Molecular Formula | C20H20F3NO6 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | [2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl] 4-acetyloxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)c2cc(C)n(CC(F)(F)F)c2C)ccc1OC(C)=O |
| InChI | InChI=1S/C20H20F3NO6/c1-11-7-15(12(2)24(11)10-20(21,22)23)16(26)9-29-19(27)14-5-6-17(30-13(3)25)18(8-14)28-4/h5-8H,9-10H2,1-4H3 |
| InChIKey | MREPWDAIJOWMFJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|