About N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline
N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline (PubChem CID 71913718) has the molecular formula C16H17N3OS2
and a molecular weight of 331.47 g/mol. Its IUPAC name is N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline.
Molecular Properties
| Compound Name | N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline |
| PubChem CID | 71913718 |
| Molecular Formula | C16H17N3OS2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline |
| SMILES | COCc1nc(CNc2cccc(-c3csc(C)n3)c2)cs1 |
| InChI | InChI=1S/C16H17N3OS2/c1-11-18-15(10-21-11)12-4-3-5-13(6-12)17-7-14-9-22-16(19-14)8-20-2/h3-6,9-10,17H,7-8H2,1-2H3 |
| InChIKey | PRCNGOAESCUIMC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline?
The IUPAC name of N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline (CID 71913718) is N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline.
What is the SMILES notation for N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline?
The canonical SMILES for N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline is COCc1nc(CNc2cccc(-c3csc(C)n3)c2)cs1.
What is the InChIKey of N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline?
The InChIKey is PRCNGOAESCUIMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3OS2/c1-11-18-15(10-21-11)12-4-3-5-13(6-12)17-7-14-9-22-16(19-14)8-20-2/h3-6,9-10,17H,7-8H2,1-2H3.
What are the key properties of N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline?
N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline has a molecular weight of 331.47 g/mol, XLogP of 4.33, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl]-3-(2-methyl-1,3-thiazol-4-yl)aniline is sourced from PubChem (CID 71913718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).