About 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide
5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 71913866) has the molecular formula C14H16ClN3O2S
and a molecular weight of 325.82 g/mol. Its IUPAC name is 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
| PubChem CID | 71913866 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCc1cnc(CCNC(=O)c2c[nH]c(C)c(Cl)c2=O)s1 |
| InChI | InChI=1S/C14H16ClN3O2S/c1-3-9-6-18-11(21-9)4-5-16-14(20)10-7-17-8(2)12(15)13(10)19/h6-7H,3-5H2,1-2H3,(H,16,20)(H,17,19) |
| InChIKey | BUHLJSYAWWXUKA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide?
The IUPAC name of 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide (CID 71913866) is 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide.
What is the SMILES notation for 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide?
The canonical SMILES for 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide is CCc1cnc(CCNC(=O)c2c[nH]c(C)c(Cl)c2=O)s1.
What is the InChIKey of 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide?
The InChIKey is BUHLJSYAWWXUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN3O2S/c1-3-9-6-18-11(21-9)4-5-16-14(20)10-7-17-8(2)12(15)13(10)19/h6-7H,3-5H2,1-2H3,(H,16,20)(H,17,19).
What are the key properties of 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide?
5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide has a molecular weight of 325.82 g/mol, XLogP of 2.33, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide is sourced from PubChem (CID 71913866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).