About methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate
methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate (PubChem CID 71914195) has the molecular formula C9H7BrF3NO3S
and a molecular weight of 346.12 g/mol. Its IUPAC name is methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate |
| PubChem CID | 71914195 |
| Molecular Formula | C9H7BrF3NO3S |
| Molecular Weight | 346.12 g/mol |
| Exact Mass | 344.93 |
| IUPAC Name | methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(Br)c(NC(=O)CC(F)(F)F)s1 |
| InChI | InChI=1S/C9H7BrF3NO3S/c1-17-8(16)5-2-4(10)7(18-5)14-6(15)3-9(11,12)13/h2H,3H2,1H3,(H,14,15) |
| InChIKey | GIMWSJUDJAMWEC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate?
The IUPAC name of methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate (CID 71914195) is methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate.
What is the SMILES notation for methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate?
The canonical SMILES for methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate is COC(=O)c1cc(Br)c(NC(=O)CC(F)(F)F)s1.
What is the InChIKey of methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate?
The InChIKey is GIMWSJUDJAMWEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrF3NO3S/c1-17-8(16)5-2-4(10)7(18-5)14-6(15)3-9(11,12)13/h2H,3H2,1H3,(H,14,15).
What are the key properties of methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate?
methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate has a molecular weight of 346.12 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-5-(3,3,3-trifluoropropanoylamino)thiophene-2-carboxylate is sourced from PubChem (CID 71914195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).