About N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide
N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide (PubChem CID 71914381) has the molecular formula C12H11F3N2OS
and a molecular weight of 288.29 g/mol. Its IUPAC name is N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide |
| PubChem CID | 71914381 |
| Molecular Formula | C12H11F3N2OS |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide |
| SMILES | N#Cc1ccccc1SCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2OS/c13-12(14,15)11(18)17-6-3-7-19-10-5-2-1-4-9(10)8-16/h1-2,4-5H,3,6-7H2,(H,17,18) |
| InChIKey | CSEMYHFDYZUEAP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide (CID 71914381) is N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide is N#Cc1ccccc1SCCCNC(=O)C(F)(F)F.
What is the InChIKey of N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide?
The InChIKey is CSEMYHFDYZUEAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2OS/c13-12(14,15)11(18)17-6-3-7-19-10-5-2-1-4-9(10)8-16/h1-2,4-5H,3,6-7H2,(H,17,18).
What are the key properties of N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide?
N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide has a molecular weight of 288.29 g/mol, XLogP of 2.72, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2-cyanophenyl)sulfanylpropyl]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 71914381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).