About 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea
1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea (PubChem CID 71915125) has the molecular formula C14H24N4O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea.
Molecular Properties
| Compound Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea |
| PubChem CID | 71915125 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea |
| SMILES | COCCC1(CNC(=O)NCc2c(C)n[nH]c2C)CC1 |
| InChI | InChI=1S/C14H24N4O2/c1-10-12(11(2)18-17-10)8-15-13(19)16-9-14(4-5-14)6-7-20-3/h4-9H2,1-3H3,(H,17,18)(H2,15,16,19) |
| InChIKey | JYJJQRAAKROBML-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea?
The IUPAC name of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea (CID 71915125) is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea.
What is the SMILES notation for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea?
The canonical SMILES for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea is COCCC1(CNC(=O)NCc2c(C)n[nH]c2C)CC1.
What is the InChIKey of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea?
The InChIKey is JYJJQRAAKROBML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O2/c1-10-12(11(2)18-17-10)8-15-13(19)16-9-14(4-5-14)6-7-20-3/h4-9H2,1-3H3,(H,17,18)(H2,15,16,19).
What are the key properties of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea?
1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea has a molecular weight of 280.37 g/mol, XLogP of 1.64, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea is sourced from PubChem (CID 71915125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).