About 1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate
1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 71915736) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is 1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate.
Analyze 1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate?
The IUPAC name of 1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate (CID 71915736) is 1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate.
What is the SMILES notation for 1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate?
The canonical SMILES for 1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate is COCC(COC)OC(=O)c1ccc2c(c1)CCC2.
What is the InChIKey of 1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate?
The InChIKey is DDJDTBZKDUJQFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-17-9-14(10-18-2)19-15(16)13-7-6-11-4-3-5-12(11)8-13/h6-8,14H,3-5,9-10H2,1-2H3.
What are the key properties of 1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate?
1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate has a molecular weight of 264.32 g/mol, XLogP of 1.99, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethoxypropan-2-yl 2,3-dihydro-1H-indene-5-carboxylate is sourced from PubChem (CID 71915736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).