About 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane
9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane (PubChem CID 71915804) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane |
| PubChem CID | 71915804 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane |
| SMILES | c1cc(CN2CCOC3(CCCC3)C2)no1 |
| InChI | InChI=1S/C12H18N2O2/c1-2-5-12(4-1)10-14(6-8-15-12)9-11-3-7-16-13-11/h3,7H,1-2,4-6,8-10H2 |
| InChIKey | NWKDMHMLZUNTNV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane?
The IUPAC name of 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane (CID 71915804) is 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane.
What is the SMILES notation for 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane?
The canonical SMILES for 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane is c1cc(CN2CCOC3(CCCC3)C2)no1.
What is the InChIKey of 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane?
The InChIKey is NWKDMHMLZUNTNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-2-5-12(4-1)10-14(6-8-15-12)9-11-3-7-16-13-11/h3,7H,1-2,4-6,8-10H2.
What are the key properties of 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane?
9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane has a molecular weight of 222.29 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(1,2-oxazol-3-ylmethyl)-6-oxa-9-azaspiro[4.5]decane is sourced from PubChem (CID 71915804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).